C27H27NO4 — CID 70106089
(2R)-2-[2-(2,3-dihydro-1H-cyclopenta[b][1]benzofuran-6-yl)-2-oxoethyl]-6-(1H-indol-3-yl)hexanoic acid (PubChem CID 70106089) has the molecular formula C27H27NO4 and a molecular weight of 429.52 g/mol. Its IUPAC name is (2R)-2-[2-(2,3-dihydro-1H-cyclopenta[b][1]benzofuran-6-yl)-2-oxoethyl]-6-(1H-indol-3-yl)hexanoic acid.
| Compound Name | (2R)-2-[2-(2,3-dihydro-1H-cyclopenta[b][1]benzofuran-6-yl)-2-oxoethyl]-6-(1H-indol-3-yl)hexanoic acid |
|---|---|
| PubChem CID | 70106089 |
| Molecular Formula | C27H27NO4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | (2R)-2-[2-(2,3-dihydro-1H-cyclopenta[b][1]benzofuran-6-yl)-2-oxoethyl]-6-(1H-indol-3-yl)hexanoic acid |
| SMILES | O=C(C[C@@H](CCCCc1c[nH]c2ccccc12)C(=O)O)c1ccc2c3c(oc2c1)CCC3 |
| InChI | InChI=1S/C27H27NO4/c29-24(17-12-13-22-21-9-5-11-25(21)32-26(22)15-17)14-18(27(30)31)6-1-2-7-19-16-28-23-10-4-3-8-20(19)23/h3-4,8,10,12-13,15-16,18,28H,1-2,5-7,9,11,14H2,(H,30,31)/t18-/m1/s1 |
| InChIKey | GOXHRBOZZHZQFA-GOSISDBHSA-N |
| XLogP | 6.09 |
| TPSA | 83.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|