C20H22N2O4S2Si — CID 77276703
3-(1H-indol-3-yl)-2-[sulfino-[5-(2-trimethylsilylethynyl)thiophen-2-yl]amino]propanoic acid (PubChem CID 77276703) has the molecular formula C20H22N2O4S2Si and a molecular weight of 446.63 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-2-[sulfino-[5-(2-trimethylsilylethynyl)thiophen-2-yl]amino]propanoic acid.
| Compound Name | 3-(1H-indol-3-yl)-2-[sulfino-[5-(2-trimethylsilylethynyl)thiophen-2-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 77276703 |
| Molecular Formula | C20H22N2O4S2Si |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | 3-(1H-indol-3-yl)-2-[sulfino-[5-(2-trimethylsilylethynyl)thiophen-2-yl]amino]propanoic acid |
| SMILES | C[Si](C)(C)C#Cc1ccc(N(C(Cc2c[nH]c3ccccc23)C(=O)O)S(=O)O)s1 |
| InChI | InChI=1S/C20H22N2O4S2Si/c1-29(2,3)11-10-15-8-9-19(27-15)22(28(25)26)18(20(23)24)12-14-13-21-17-7-5-4-6-16(14)17/h4-9,13,18,21H,12H2,1-3H3,(H,23,24)(H,25,26) |
| InChIKey | HFFMHUUXWUNZMJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|