C28H33NO4 — CID 18318898
2-[(2Z)-2-hydroxyimino-2-(6,7,8,9-tetrahydrodibenzofuran-3-yl)ethyl]-8-phenyloctanoic acid (PubChem CID 18318898) has the molecular formula C28H33NO4 and a molecular weight of 447.58 g/mol. Its IUPAC name is 2-[(2Z)-2-hydroxyimino-2-(6,7,8,9-tetrahydrodibenzofuran-3-yl)ethyl]-8-phenyloctanoic acid.
| Compound Name | 2-[(2Z)-2-hydroxyimino-2-(6,7,8,9-tetrahydrodibenzofuran-3-yl)ethyl]-8-phenyloctanoic acid |
|---|---|
| PubChem CID | 18318898 |
| Molecular Formula | C28H33NO4 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | 2-[(2Z)-2-hydroxyimino-2-(6,7,8,9-tetrahydrodibenzofuran-3-yl)ethyl]-8-phenyloctanoic acid |
| SMILES | O=C(O)C(CCCCCCc1ccccc1)C/C(=N/O)c1ccc2c3c(oc2c1)CCCC3 |
| InChI | InChI=1S/C28H33NO4/c30-28(31)22(13-7-2-1-4-10-20-11-5-3-6-12-20)18-25(29-32)21-16-17-24-23-14-8-9-15-26(23)33-27(24)19-21/h3,5-6,11-12,16-17,19,22,32H,1-2,4,7-10,13-15,18H2,(H,30,31)/b29-25- |
| InChIKey | RHPWPSMHCGLGOM-GNVQSUKOSA-N |
| XLogP | 6.77 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|