C15H17NO5S — CID 139943090
2-(6,7,8,9-tetrahydrodibenzofuran-3-ylsulfonylamino)propanoic acid (PubChem CID 139943090) has the molecular formula C15H17NO5S and a molecular weight of 323.37 g/mol. Its IUPAC name is 2-(6,7,8,9-tetrahydrodibenzofuran-3-ylsulfonylamino)propanoic acid.
| Compound Name | 2-(6,7,8,9-tetrahydrodibenzofuran-3-ylsulfonylamino)propanoic acid |
|---|---|
| PubChem CID | 139943090 |
| Molecular Formula | C15H17NO5S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 2-(6,7,8,9-tetrahydrodibenzofuran-3-ylsulfonylamino)propanoic acid |
| SMILES | CC(NS(=O)(=O)c1ccc2c3c(oc2c1)CCCC3)C(=O)O |
| InChI | InChI=1S/C15H17NO5S/c1-9(15(17)18)16-22(19,20)10-6-7-12-11-4-2-3-5-13(11)21-14(12)8-10/h6-9,16H,2-5H2,1H3,(H,17,18) |
| InChIKey | LOQVGAPMYXXSSU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |