C20H16N2O5S2 — CID 23297849
N-hydroxy-2-(phenoxathiin-2-ylsulfonylamino)-2-phenylacetamide (PubChem CID 23297849) has the molecular formula C20H16N2O5S2 and a molecular weight of 428.49 g/mol. Its IUPAC name is N-hydroxy-2-(phenoxathiin-2-ylsulfonylamino)-2-phenylacetamide.
| Compound Name | N-hydroxy-2-(phenoxathiin-2-ylsulfonylamino)-2-phenylacetamide |
|---|---|
| PubChem CID | 23297849 |
| Molecular Formula | C20H16N2O5S2 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | N-hydroxy-2-(phenoxathiin-2-ylsulfonylamino)-2-phenylacetamide |
| SMILES | O=C(NO)C(NS(=O)(=O)c1ccc2c(c1)Sc1ccccc1O2)c1ccccc1 |
| InChI | InChI=1S/C20H16N2O5S2/c23-20(21-24)19(13-6-2-1-3-7-13)22-29(25,26)14-10-11-16-18(12-14)28-17-9-5-4-8-15(17)27-16/h1-12,19,22,24H,(H,21,23) |
| InChIKey | WOOOIJMUCYGXFB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|