C16H15NO6S — CID 15487610
(2S)-3-hydroxy-2-(9H-xanthen-2-ylsulfonylamino)propanoic acid (PubChem CID 15487610) has the molecular formula C16H15NO6S and a molecular weight of 349.36 g/mol. Its IUPAC name is (2S)-3-hydroxy-2-(9H-xanthen-2-ylsulfonylamino)propanoic acid.
| Compound Name | (2S)-3-hydroxy-2-(9H-xanthen-2-ylsulfonylamino)propanoic acid |
|---|---|
| PubChem CID | 15487610 |
| Molecular Formula | C16H15NO6S |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | (2S)-3-hydroxy-2-(9H-xanthen-2-ylsulfonylamino)propanoic acid |
| SMILES | O=C(O)[C@H](CO)NS(=O)(=O)c1ccc2c(c1)Cc1ccccc1O2 |
| InChI | InChI=1S/C16H15NO6S/c18-9-13(16(19)20)17-24(21,22)12-5-6-15-11(8-12)7-10-3-1-2-4-14(10)23-15/h1-6,8,13,17-18H,7,9H2,(H,19,20)/t13-/m0/s1 |
| InChIKey | OAWOSXRMQNBWAA-ZDUSSCGKSA-N |
| XLogP | 1.11 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |