C33H27N3O5S2 — CID 11828185
(4-benzyl-6-phenoxathiin-2-ylpyridazin-3-yl) 2-[(4-methylphenyl)sulfonylamino]propanoate (PubChem CID 11828185) has the molecular formula C33H27N3O5S2 and a molecular weight of 609.73 g/mol. Its IUPAC name is (4-benzyl-6-phenoxathiin-2-ylpyridazin-3-yl) 2-[(4-methylphenyl)sulfonylamino]propanoate.
| Compound Name | (4-benzyl-6-phenoxathiin-2-ylpyridazin-3-yl) 2-[(4-methylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 11828185 |
| Molecular Formula | C33H27N3O5S2 |
| Molecular Weight | 609.73 g/mol |
| Exact Mass | 609.14 |
| IUPAC Name | (4-benzyl-6-phenoxathiin-2-ylpyridazin-3-yl) 2-[(4-methylphenyl)sulfonylamino]propanoate |
| SMILES | Cc1ccc(S(=O)(=O)NC(C)C(=O)Oc2nnc(-c3ccc4c(c3)Sc3ccccc3O4)cc2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C33H27N3O5S2/c1-21-12-15-26(16-13-21)43(38,39)36-22(2)33(37)41-32-25(18-23-8-4-3-5-9-23)19-27(34-35-32)24-14-17-29-31(20-24)42-30-11-7-6-10-28(30)40-29/h3-17,19-20,22,36H,18H2,1-2H3 |
| InChIKey | GZVQKQICPGGQEO-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 107.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.73 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |