C29H31N5O8S — CID 70062744
(2S)-3-[4-[[4-[carbamimidoyl(phenylmethoxycarbonyl)amino]-4-oxobutanoyl]amino]phenyl]-2-[(2-methylphenyl)sulfonylamino]propanoic acid (PubChem CID 70062744) has the molecular formula C29H31N5O8S and a molecular weight of 609.66 g/mol. Its IUPAC name is (2S)-3-[4-[[4-[carbamimidoyl(phenylmethoxycarbonyl)amino]-4-oxobutanoyl]amino]phenyl]-2-[(2-methylphenyl)sulfonylamino]propanoic acid.
| Compound Name | (2S)-3-[4-[[4-[carbamimidoyl(phenylmethoxycarbonyl)amino]-4-oxobutanoyl]amino]phenyl]-2-[(2-methylphenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 70062744 |
| Molecular Formula | C29H31N5O8S |
| Molecular Weight | 609.66 g/mol |
| Exact Mass | 609.19 |
| IUPAC Name | (2S)-3-[4-[[4-[carbamimidoyl(phenylmethoxycarbonyl)amino]-4-oxobutanoyl]amino]phenyl]-2-[(2-methylphenyl)sulfonylamino]propanoic acid |
| SMILES | [H]/N=C(\N)N(C(=O)CCC(=O)Nc1ccc(C[C@H](NS(=O)(=O)c2ccccc2C)C(=O)O)cc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C29H31N5O8S/c1-19-7-5-6-10-24(19)43(40,41)33-23(27(37)38)17-20-11-13-22(14-12-20)32-25(35)15-16-26(36)34(28(30)31)29(39)42-18-21-8-3-2-4-9-21/h2-14,23,33H,15-18H2,1H3,(H3,30,31)(H,32,35)(H,37,38)/t23-/m0/s1 |
| InChIKey | ZRLZSFPGQSEFCH-QHCPKHFHSA-N |
| XLogP | 2.75 |
| TPSA | 209.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.66 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|