C10H14N2O3S — CID 79673212
N-(2-amino-5-methoxyphenyl)prop-2-ene-1-sulfonamide (PubChem CID 79673212) has the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. Its IUPAC name is N-(2-amino-5-methoxyphenyl)prop-2-ene-1-sulfonamide.
| Compound Name | N-(2-amino-5-methoxyphenyl)prop-2-ene-1-sulfonamide |
|---|---|
| PubChem CID | 79673212 |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | N-(2-amino-5-methoxyphenyl)prop-2-ene-1-sulfonamide |
| SMILES | C=CCS(=O)(=O)Nc1cc(OC)ccc1N |
| InChI | InChI=1S/C10H14N2O3S/c1-3-6-16(13,14)12-10-7-8(15-2)4-5-9(10)11/h3-5,7,12H,1,6,11H2,2H3 |
| InChIKey | BDDICCVKGAHRBX-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|