C11H18N2O4 — CID 107845814
2-(2-amino-5-methoxyanilino)-2-(hydroxymethyl)propane-1,3-diol (PubChem CID 107845814) has the molecular formula C11H18N2O4 and a molecular weight of 242.28 g/mol. Its IUPAC name is 2-(2-amino-5-methoxyanilino)-2-(hydroxymethyl)propane-1,3-diol.
| Compound Name | 2-(2-amino-5-methoxyanilino)-2-(hydroxymethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 107845814 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 2-(2-amino-5-methoxyanilino)-2-(hydroxymethyl)propane-1,3-diol |
| SMILES | COc1ccc(N)c(NC(CO)(CO)CO)c1 |
| InChI | InChI=1S/C11H18N2O4/c1-17-8-2-3-9(12)10(4-8)13-11(5-14,6-15)7-16/h2-4,13-16H,5-7,12H2,1H3 |
| InChIKey | BRDYLBCVSKEDCO-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|