C12H20N2O5 — CID 107845823
2-(2-amino-4,5-dimethoxyanilino)-2-(hydroxymethyl)propane-1,3-diol (PubChem CID 107845823) has the molecular formula C12H20N2O5 and a molecular weight of 272.30 g/mol. Its IUPAC name is 2-(2-amino-4,5-dimethoxyanilino)-2-(hydroxymethyl)propane-1,3-diol.
| Compound Name | 2-(2-amino-4,5-dimethoxyanilino)-2-(hydroxymethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 107845823 |
| Molecular Formula | C12H20N2O5 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 2-(2-amino-4,5-dimethoxyanilino)-2-(hydroxymethyl)propane-1,3-diol |
| SMILES | COc1cc(N)c(NC(CO)(CO)CO)cc1OC |
| InChI | InChI=1S/C12H20N2O5/c1-18-10-3-8(13)9(4-11(10)19-2)14-12(5-15,6-16)7-17/h3-4,14-17H,5-7,13H2,1-2H3 |
| InChIKey | LGNGLDORWCVJEL-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|