C8H10N2OS2 — CID 169433846
(2-amino-5-methoxyphenyl)carbamodithioic acid (PubChem CID 169433846) has the molecular formula C8H10N2OS2 and a molecular weight of 214.31 g/mol. Its IUPAC name is (2-amino-5-methoxyphenyl)carbamodithioic acid.
| Compound Name | (2-amino-5-methoxyphenyl)carbamodithioic acid |
|---|---|
| PubChem CID | 169433846 |
| Molecular Formula | C8H10N2OS2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.02 |
| IUPAC Name | (2-amino-5-methoxyphenyl)carbamodithioic acid |
| SMILES | COc1ccc(N)c(NC(=S)S)c1 |
| InChI | InChI=1S/C8H10N2OS2/c1-11-5-2-3-6(9)7(4-5)10-8(12)13/h2-4H,9H2,1H3,(H2,10,12,13) |
| InChIKey | OQJRSCKELIRKCF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|