C21H26N2O5S — CID 174437621
anisole;N-hydroxy-3-[2-phenylethenyl(prop-2-enylsulfonyl)amino]propanamide (PubChem CID 174437621) has the molecular formula C21H26N2O5S and a molecular weight of 418.52 g/mol. Its IUPAC name is anisole;N-hydroxy-3-[2-phenylethenyl(prop-2-enylsulfonyl)amino]propanamide.
| Compound Name | anisole;N-hydroxy-3-[2-phenylethenyl(prop-2-enylsulfonyl)amino]propanamide |
|---|---|
| PubChem CID | 174437621 |
| Molecular Formula | C21H26N2O5S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | anisole;N-hydroxy-3-[2-phenylethenyl(prop-2-enylsulfonyl)amino]propanamide |
| SMILES | C=CCS(=O)(=O)N(C=Cc1ccccc1)CCC(=O)NO.COc1ccccc1 |
| InChI | InChI=1S/C14H18N2O4S.C7H8O/c1-2-12-21(19,20)16(11-9-14(17)15-18)10-8-13-6-4-3-5-7-13;1-8-7-5-3-2-4-6-7/h2-8,10,18H,1,9,11-12H2,(H,15,17);2-6H,1H3 |
| InChIKey | AGWBNUXRFJANKD-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|