C25H25N3O3S — CID 174392438
anisole;N-phenyl-N-(1-phenylpyrazol-4-yl)prop-2-ene-1-sulfonamide (PubChem CID 174392438) has the molecular formula C25H25N3O3S and a molecular weight of 447.56 g/mol. Its IUPAC name is anisole;N-phenyl-N-(1-phenylpyrazol-4-yl)prop-2-ene-1-sulfonamide.
| Compound Name | anisole;N-phenyl-N-(1-phenylpyrazol-4-yl)prop-2-ene-1-sulfonamide |
|---|---|
| PubChem CID | 174392438 |
| Molecular Formula | C25H25N3O3S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | anisole;N-phenyl-N-(1-phenylpyrazol-4-yl)prop-2-ene-1-sulfonamide |
| SMILES | C=CCS(=O)(=O)N(c1ccccc1)c1cnn(-c2ccccc2)c1.COc1ccccc1 |
| InChI | InChI=1S/C18H17N3O2S.C7H8O/c1-2-13-24(22,23)21(17-11-7-4-8-12-17)18-14-19-20(15-18)16-9-5-3-6-10-16;1-8-7-5-3-2-4-6-7/h2-12,14-15H,1,13H2;2-6H,1H3 |
| InChIKey | XYYSMJCVRVGTTG-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|