C12H15NO2 — CID 174766085
2-phenylethenyl(propyl)carbamic acid (PubChem CID 174766085) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 2-phenylethenyl(propyl)carbamic acid.
| Compound Name | 2-phenylethenyl(propyl)carbamic acid |
|---|---|
| PubChem CID | 174766085 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 2-phenylethenyl(propyl)carbamic acid |
| SMILES | CCCN(C=Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C12H15NO2/c1-2-9-13(12(14)15)10-8-11-6-4-3-5-7-11/h3-8,10H,2,9H2,1H3,(H,14,15) |
| InChIKey | HIULWPKLRNGOME-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |