C16H21NO2 — CID 174583439
2,2-dimethyl-N-(2-phenylethenyl)-N-propanoylpropanamide (PubChem CID 174583439) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is 2,2-dimethyl-N-(2-phenylethenyl)-N-propanoylpropanamide.
| Compound Name | 2,2-dimethyl-N-(2-phenylethenyl)-N-propanoylpropanamide |
|---|---|
| PubChem CID | 174583439 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 2,2-dimethyl-N-(2-phenylethenyl)-N-propanoylpropanamide |
| SMILES | CCC(=O)N(C=Cc1ccccc1)C(=O)C(C)(C)C |
| InChI | InChI=1S/C16H21NO2/c1-5-14(18)17(15(19)16(2,3)4)12-11-13-9-7-6-8-10-13/h6-12H,5H2,1-4H3 |
| InChIKey | ZZIFNRJGEANXQF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |