C18H26N2O — CID 79116877
N-(4-aminocyclohexyl)-3-phenyl-N-propylprop-2-enamide (PubChem CID 79116877) has the molecular formula C18H26N2O and a molecular weight of 286.42 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-3-phenyl-N-propylprop-2-enamide.
| Compound Name | N-(4-aminocyclohexyl)-3-phenyl-N-propylprop-2-enamide |
|---|---|
| PubChem CID | 79116877 |
| Molecular Formula | C18H26N2O |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | N-(4-aminocyclohexyl)-3-phenyl-N-propylprop-2-enamide |
| SMILES | CCCN(C(=O)C=Cc1ccccc1)C1CCC(N)CC1 |
| InChI | InChI=1S/C18H26N2O/c1-2-14-20(17-11-9-16(19)10-12-17)18(21)13-8-15-6-4-3-5-7-15/h3-8,13,16-17H,2,9-12,14,19H2,1H3 |
| InChIKey | HIHMFYVBFFZJAX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|