C26H31N3O4 — CID 56523077
(E)-3-[4-(2-amino-2-oxoethoxy)phenyl]-N-(1-benzoylpiperidin-4-yl)-N-propylprop-2-enamide (PubChem CID 56523077) has the molecular formula C26H31N3O4 and a molecular weight of 449.55 g/mol. Its IUPAC name is (E)-3-[4-(2-amino-2-oxoethoxy)phenyl]-N-(1-benzoylpiperidin-4-yl)-N-propylprop-2-enamide.
| Compound Name | (E)-3-[4-(2-amino-2-oxoethoxy)phenyl]-N-(1-benzoylpiperidin-4-yl)-N-propylprop-2-enamide |
|---|---|
| PubChem CID | 56523077 |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | (E)-3-[4-(2-amino-2-oxoethoxy)phenyl]-N-(1-benzoylpiperidin-4-yl)-N-propylprop-2-enamide |
| SMILES | CCCN(C(=O)/C=C/c1ccc(OCC(N)=O)cc1)C1CCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H31N3O4/c1-2-16-29(22-14-17-28(18-15-22)26(32)21-6-4-3-5-7-21)25(31)13-10-20-8-11-23(12-9-20)33-19-24(27)30/h3-13,22H,2,14-19H2,1H3,(H2,27,30)/b13-10+ |
| InChIKey | IJDVEPOBMCEYKC-JLHYYAGUSA-N |
| XLogP | 3.11 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|