C26H30N2O — CID 101154683
(2S)-N,N-dibenzyl-1-(4-methoxyphenyl)imino-3-methylbutan-2-amine (PubChem CID 101154683) has the molecular formula C26H30N2O and a molecular weight of 386.54 g/mol. Its IUPAC name is (2S)-N,N-dibenzyl-1-(4-methoxyphenyl)imino-3-methylbutan-2-amine.
| Compound Name | (2S)-N,N-dibenzyl-1-(4-methoxyphenyl)imino-3-methylbutan-2-amine |
|---|---|
| PubChem CID | 101154683 |
| Molecular Formula | C26H30N2O |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | (2S)-N,N-dibenzyl-1-(4-methoxyphenyl)imino-3-methylbutan-2-amine |
| SMILES | COc1ccc(/N=C/[C@H](C(C)C)N(Cc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C26H30N2O/c1-21(2)26(18-27-24-14-16-25(29-3)17-15-24)28(19-22-10-6-4-7-11-22)20-23-12-8-5-9-13-23/h4-18,21,26H,19-20H2,1-3H3/b27-18+/t26-/m1/s1 |
| InChIKey | KGEAEFZXACKFBX-HNXXGLCESA-N |
| XLogP | 6.12 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|