C22H29NO3S — CID 137398530
N,N-bis[(4-methoxyphenyl)methyl]-2-methylpent-4-ene-1-sulfinamide (PubChem CID 137398530) has the molecular formula C22H29NO3S and a molecular weight of 387.55 g/mol. Its IUPAC name is N,N-bis[(4-methoxyphenyl)methyl]-2-methylpent-4-ene-1-sulfinamide.
| Compound Name | N,N-bis[(4-methoxyphenyl)methyl]-2-methylpent-4-ene-1-sulfinamide |
|---|---|
| PubChem CID | 137398530 |
| Molecular Formula | C22H29NO3S |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | N,N-bis[(4-methoxyphenyl)methyl]-2-methylpent-4-ene-1-sulfinamide |
| SMILES | C=CCC(C)CS(=O)N(Cc1ccc(OC)cc1)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C22H29NO3S/c1-5-6-18(2)17-27(24)23(15-19-7-11-21(25-3)12-8-19)16-20-9-13-22(26-4)14-10-20/h5,7-14,18H,1,6,15-17H2,2-4H3 |
| InChIKey | PPNKICRXAUGASN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|