C24H22F4N2O3S — CID 170677434
N-benzyl-3-fluoro-N-[(4-methoxyphenyl)methyl]-6-prop-2-enylsulfonyl-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 170677434) has the molecular formula C24H22F4N2O3S and a molecular weight of 494.51 g/mol. Its IUPAC name is N-benzyl-3-fluoro-N-[(4-methoxyphenyl)methyl]-6-prop-2-enylsulfonyl-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-benzyl-3-fluoro-N-[(4-methoxyphenyl)methyl]-6-prop-2-enylsulfonyl-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 170677434 |
| Molecular Formula | C24H22F4N2O3S |
| Molecular Weight | 494.51 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | N-benzyl-3-fluoro-N-[(4-methoxyphenyl)methyl]-6-prop-2-enylsulfonyl-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | C=CCS(=O)(=O)c1nc(N(Cc2ccccc2)Cc2ccc(OC)cc2)c(F)cc1C(F)(F)F |
| InChI | InChI=1S/C24H22F4N2O3S/c1-3-13-34(31,32)23-20(24(26,27)28)14-21(25)22(29-23)30(15-17-7-5-4-6-8-17)16-18-9-11-19(33-2)12-10-18/h3-12,14H,1,13,15-16H2,2H3 |
| InChIKey | MDTNQINJEDKYCN-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.51 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|