C18H18F3NO3S — CID 112787907
4-methoxy-N-prop-2-enyl-N-[[3-(trifluoromethyl)phenyl]methyl]benzenesulfonamide (PubChem CID 112787907) has the molecular formula C18H18F3NO3S and a molecular weight of 385.41 g/mol. Its IUPAC name is 4-methoxy-N-prop-2-enyl-N-[[3-(trifluoromethyl)phenyl]methyl]benzenesulfonamide.
| Compound Name | 4-methoxy-N-prop-2-enyl-N-[[3-(trifluoromethyl)phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 112787907 |
| Molecular Formula | C18H18F3NO3S |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 4-methoxy-N-prop-2-enyl-N-[[3-(trifluoromethyl)phenyl]methyl]benzenesulfonamide |
| SMILES | C=CCN(Cc1cccc(C(F)(F)F)c1)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H18F3NO3S/c1-3-11-22(13-14-5-4-6-15(12-14)18(19,20)21)26(23,24)17-9-7-16(25-2)8-10-17/h3-10,12H,1,11,13H2,2H3 |
| InChIKey | JIWBTOQJRLCFIC-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|