C18H14ClF3N2O2S — CID 134045256
2-chloro-N-[(3-cyanophenyl)methyl]-N-prop-2-enyl-5-(trifluoromethyl)benzenesulfonamide (PubChem CID 134045256) has the molecular formula C18H14ClF3N2O2S and a molecular weight of 414.84 g/mol. Its IUPAC name is 2-chloro-N-[(3-cyanophenyl)methyl]-N-prop-2-enyl-5-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 2-chloro-N-[(3-cyanophenyl)methyl]-N-prop-2-enyl-5-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 134045256 |
| Molecular Formula | C18H14ClF3N2O2S |
| Molecular Weight | 414.84 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | 2-chloro-N-[(3-cyanophenyl)methyl]-N-prop-2-enyl-5-(trifluoromethyl)benzenesulfonamide |
| SMILES | C=CCN(Cc1cccc(C#N)c1)S(=O)(=O)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C18H14ClF3N2O2S/c1-2-8-24(12-14-5-3-4-13(9-14)11-23)27(25,26)17-10-15(18(20,21)22)6-7-16(17)19/h2-7,9-10H,1,8,12H2 |
| InChIKey | IKJAJTJSFRKZOS-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.84 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|