C20H18BrFN2O — CID 171619528
N,N-dibenzyl-6-bromo-5-fluoro-2-methoxypyridin-3-amine (PubChem CID 171619528) has the molecular formula C20H18BrFN2O and a molecular weight of 401.28 g/mol. Its IUPAC name is N,N-dibenzyl-6-bromo-5-fluoro-2-methoxypyridin-3-amine.
| Compound Name | N,N-dibenzyl-6-bromo-5-fluoro-2-methoxypyridin-3-amine |
|---|---|
| PubChem CID | 171619528 |
| Molecular Formula | C20H18BrFN2O |
| Molecular Weight | 401.28 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | N,N-dibenzyl-6-bromo-5-fluoro-2-methoxypyridin-3-amine |
| SMILES | COc1nc(Br)c(F)cc1N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C20H18BrFN2O/c1-25-20-18(12-17(22)19(21)23-20)24(13-15-8-4-2-5-9-15)14-16-10-6-3-7-11-16/h2-12H,13-14H2,1H3 |
| InChIKey | VLSCJFMXWYGCDF-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.28 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|