C30H35BF3NO4 — CID 170594308
4-(difluoromethyl)-2-fluoro-N,N-bis[(4-methoxyphenyl)methyl]-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline (PubChem CID 170594308) has the molecular formula C30H35BF3NO4 and a molecular weight of 541.42 g/mol. Its IUPAC name is 4-(difluoromethyl)-2-fluoro-N,N-bis[(4-methoxyphenyl)methyl]-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline.
| Compound Name | 4-(difluoromethyl)-2-fluoro-N,N-bis[(4-methoxyphenyl)methyl]-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
|---|---|
| PubChem CID | 170594308 |
| Molecular Formula | C30H35BF3NO4 |
| Molecular Weight | 541.42 g/mol |
| Exact Mass | 541.26 |
| IUPAC Name | 4-(difluoromethyl)-2-fluoro-N,N-bis[(4-methoxyphenyl)methyl]-3-methyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2)c2cc(B3OC(C)(C)C(C)(C)O3)c(C(F)F)c(C)c2F)cc1 |
| InChI | InChI=1S/C30H35BF3NO4/c1-19-26(28(33)34)24(31-38-29(2,3)30(4,5)39-31)16-25(27(19)32)35(17-20-8-12-22(36-6)13-9-20)18-21-10-14-23(37-7)15-11-21/h8-16,28H,17-18H2,1-7H3 |
| InChIKey | SGILUQNLKSBCFD-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.42 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|