C22H23BrN2O5S — CID 146284828
2-[bis[(2,4-dimethoxyphenyl)methyl]amino]-4-bromo-1,3-thiazole-5-carbaldehyde (PubChem CID 146284828) has the molecular formula C22H23BrN2O5S and a molecular weight of 507.41 g/mol. Its IUPAC name is 2-[bis[(2,4-dimethoxyphenyl)methyl]amino]-4-bromo-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-[bis[(2,4-dimethoxyphenyl)methyl]amino]-4-bromo-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 146284828 |
| Molecular Formula | C22H23BrN2O5S |
| Molecular Weight | 507.41 g/mol |
| Exact Mass | 506.05 |
| IUPAC Name | 2-[bis[(2,4-dimethoxyphenyl)methyl]amino]-4-bromo-1,3-thiazole-5-carbaldehyde |
| SMILES | COc1ccc(CN(Cc2ccc(OC)cc2OC)c2nc(Br)c(C=O)s2)c(OC)c1 |
| InChI | InChI=1S/C22H23BrN2O5S/c1-27-16-7-5-14(18(9-16)29-3)11-25(22-24-21(23)20(13-26)31-22)12-15-6-8-17(28-2)10-19(15)30-4/h5-10,13H,11-12H2,1-4H3 |
| InChIKey | WJGAJFDUGAVPKE-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 70.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.41 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|