C17H23N3O2 — CID 118510223
6-tert-butyl-N-[(2,4-dimethoxyphenyl)methyl]pyrazin-2-amine (PubChem CID 118510223) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 6-tert-butyl-N-[(2,4-dimethoxyphenyl)methyl]pyrazin-2-amine.
| Compound Name | 6-tert-butyl-N-[(2,4-dimethoxyphenyl)methyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 118510223 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 6-tert-butyl-N-[(2,4-dimethoxyphenyl)methyl]pyrazin-2-amine |
| SMILES | COc1ccc(CNc2cncc(C(C)(C)C)n2)c(OC)c1 |
| InChI | InChI=1S/C17H23N3O2/c1-17(2,3)15-10-18-11-16(20-15)19-9-12-6-7-13(21-4)8-14(12)22-5/h6-8,10-11H,9H2,1-5H3,(H,19,20) |
| InChIKey | KKVMZQMONPBKOA-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |