C15H17N3O2S — CID 64596075
6-[(2,4-dimethoxyphenyl)methylamino]pyridine-2-carbothioamide (PubChem CID 64596075) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is 6-[(2,4-dimethoxyphenyl)methylamino]pyridine-2-carbothioamide.
| Compound Name | 6-[(2,4-dimethoxyphenyl)methylamino]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 64596075 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 6-[(2,4-dimethoxyphenyl)methylamino]pyridine-2-carbothioamide |
| SMILES | COc1ccc(CNc2cccc(C(N)=S)n2)c(OC)c1 |
| InChI | InChI=1S/C15H17N3O2S/c1-19-11-7-6-10(13(8-11)20-2)9-17-14-5-3-4-12(18-14)15(16)21/h3-8H,9H2,1-2H3,(H2,16,21)(H,17,18) |
| InChIKey | GZWNCLIAYOUZHW-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|