C16H17F2N3O3 — CID 178073128
3-(1,1-difluoroethyl)-6-[(2,4-dimethoxyphenyl)methylamino]pyrazine-2-carbaldehyde (PubChem CID 178073128) has the molecular formula C16H17F2N3O3 and a molecular weight of 337.33 g/mol. Its IUPAC name is 3-(1,1-difluoroethyl)-6-[(2,4-dimethoxyphenyl)methylamino]pyrazine-2-carbaldehyde.
| Compound Name | 3-(1,1-difluoroethyl)-6-[(2,4-dimethoxyphenyl)methylamino]pyrazine-2-carbaldehyde |
|---|---|
| PubChem CID | 178073128 |
| Molecular Formula | C16H17F2N3O3 |
| Molecular Weight | 337.33 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 3-(1,1-difluoroethyl)-6-[(2,4-dimethoxyphenyl)methylamino]pyrazine-2-carbaldehyde |
| SMILES | COc1ccc(CNc2cnc(C(C)(F)F)c(C=O)n2)c(OC)c1 |
| InChI | InChI=1S/C16H17F2N3O3/c1-16(17,18)15-12(9-22)21-14(8-20-15)19-7-10-4-5-11(23-2)6-13(10)24-3/h4-6,8-9H,7H2,1-3H3,(H,19,21) |
| InChIKey | FJJLJTNIPHXSSG-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|