C14H14I2N2O2 — CID 167328439
N-[(2,4-dimethoxyphenyl)methyl]-4,5-diiodopyridin-2-amine (PubChem CID 167328439) has the molecular formula C14H14I2N2O2 and a molecular weight of 496.09 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-4,5-diiodopyridin-2-amine.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-4,5-diiodopyridin-2-amine |
|---|---|
| PubChem CID | 167328439 |
| Molecular Formula | C14H14I2N2O2 |
| Molecular Weight | 496.09 g/mol |
| Exact Mass | 495.91 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-4,5-diiodopyridin-2-amine |
| SMILES | COc1ccc(CNc2cc(I)c(I)cn2)c(OC)c1 |
| InChI | InChI=1S/C14H14I2N2O2/c1-19-10-4-3-9(13(5-10)20-2)7-17-14-6-11(15)12(16)8-18-14/h3-6,8H,7H2,1-2H3,(H,17,18) |
| InChIKey | WAIDDKHFQBIGAP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.09 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|