C21H22BrF2N3O4 — CID 167698309
2-bromo-3-fluoro-4-methoxypyridine;N-[(2,4-dimethoxyphenyl)methyl]-3-fluoro-4-methoxypyridin-2-amine (PubChem CID 167698309) has the molecular formula C21H22BrF2N3O4 and a molecular weight of 498.32 g/mol. Its IUPAC name is 2-bromo-3-fluoro-4-methoxypyridine;N-[(2,4-dimethoxyphenyl)methyl]-3-fluoro-4-methoxypyridin-2-amine.
| Compound Name | 2-bromo-3-fluoro-4-methoxypyridine;N-[(2,4-dimethoxyphenyl)methyl]-3-fluoro-4-methoxypyridin-2-amine |
|---|---|
| PubChem CID | 167698309 |
| Molecular Formula | C21H22BrF2N3O4 |
| Molecular Weight | 498.32 g/mol |
| Exact Mass | 497.08 |
| IUPAC Name | 2-bromo-3-fluoro-4-methoxypyridine;N-[(2,4-dimethoxyphenyl)methyl]-3-fluoro-4-methoxypyridin-2-amine |
| SMILES | COc1ccc(CNc2nccc(OC)c2F)c(OC)c1.COc1ccnc(Br)c1F |
| InChI | InChI=1S/C15H17FN2O3.C6H5BrFNO/c1-19-11-5-4-10(13(8-11)21-3)9-18-15-14(16)12(20-2)6-7-17-15;1-10-4-2-3-9-6(7)5(4)8/h4-8H,9H2,1-3H3,(H,17,18);2-3H,1H3 |
| InChIKey | XZNCTJDJWGILLH-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.32 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|