C22H23N3O4 — CID 113019975
N-[6-(2,5-dimethoxyanilino)-3-pyridinyl]-2-(4-methoxyphenyl)acetamide (PubChem CID 113019975) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is N-[6-(2,5-dimethoxyanilino)-3-pyridinyl]-2-(4-methoxyphenyl)acetamide.
| Compound Name | N-[6-(2,5-dimethoxyanilino)-3-pyridinyl]-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 113019975 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N-[6-(2,5-dimethoxyanilino)-3-pyridinyl]-2-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)Nc2ccc(Nc3cc(OC)ccc3OC)nc2)cc1 |
| InChI | InChI=1S/C22H23N3O4/c1-27-17-7-4-15(5-8-17)12-22(26)24-16-6-11-21(23-14-16)25-19-13-18(28-2)9-10-20(19)29-3/h4-11,13-14H,12H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | WWKSTWQWYDXCPP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |