C13H18N2O4S — CID 39419244
N-(2-cyanoethyl)-N-ethyl-3,4-dimethoxybenzenesulfonamide (PubChem CID 39419244) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N-ethyl-3,4-dimethoxybenzenesulfonamide.
| Compound Name | N-(2-cyanoethyl)-N-ethyl-3,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 39419244 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | N-(2-cyanoethyl)-N-ethyl-3,4-dimethoxybenzenesulfonamide |
| SMILES | CCN(CCC#N)S(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C13H18N2O4S/c1-4-15(9-5-8-14)20(16,17)11-6-7-12(18-2)13(10-11)19-3/h6-7,10H,4-5,9H2,1-3H3 |
| InChIKey | BBSKDMLDQHAZSO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |