C16H14NO5PS — CID 165416600
[5-[(Z)-2-(1,3-benzothiazol-2-yl)ethenyl]-2-methoxyphenyl] dihydrogen phosphate (PubChem CID 165416600) has the molecular formula C16H14NO5PS and a molecular weight of 363.33 g/mol. Its IUPAC name is [5-[(Z)-2-(1,3-benzothiazol-2-yl)ethenyl]-2-methoxyphenyl] dihydrogen phosphate.
| Compound Name | [5-[(Z)-2-(1,3-benzothiazol-2-yl)ethenyl]-2-methoxyphenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 165416600 |
| Molecular Formula | C16H14NO5PS |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | [5-[(Z)-2-(1,3-benzothiazol-2-yl)ethenyl]-2-methoxyphenyl] dihydrogen phosphate |
| SMILES | COc1ccc(/C=C\c2nc3ccccc3s2)cc1OP(=O)(O)O |
| InChI | InChI=1S/C16H14NO5PS/c1-21-13-8-6-11(10-14(13)22-23(18,19)20)7-9-16-17-12-4-2-3-5-15(12)24-16/h2-10H,1H3,(H2,18,19,20)/b9-7- |
| InChIKey | VCQRTTZQNNBCSD-CLFYSBASSA-N |
| XLogP | 3.95 |
| TPSA | 88.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|