About 5-methyl-2-(4-pyridin-2-ylbuta-1,3-dienyl)pyridine
5-methyl-2-(4-pyridin-2-ylbuta-1,3-dienyl)pyridine (PubChem CID 91023866) has the molecular formula C15H14N2
and a molecular weight of 222.29 g/mol. Its IUPAC name is 5-methyl-2-(4-pyridin-2-ylbuta-1,3-dienyl)pyridine.
Molecular Properties
| Compound Name | 5-methyl-2-(4-pyridin-2-ylbuta-1,3-dienyl)pyridine |
| PubChem CID | 91023866 |
| Molecular Formula | C15H14N2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 5-methyl-2-(4-pyridin-2-ylbuta-1,3-dienyl)pyridine |
| SMILES | Cc1ccc(C=CC=Cc2ccccn2)nc1 |
| InChI | InChI=1S/C15H14N2/c1-13-9-10-15(17-12-13)7-3-2-6-14-8-4-5-11-16-14/h2-12H,1H3 |
| InChIKey | AIQCYSUVMRMQNG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-2-(4-pyridin-2-ylbuta-1,3-dienyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-(4-pyridin-2-ylbuta-1,3-dienyl)pyridine?
The IUPAC name of 5-methyl-2-(4-pyridin-2-ylbuta-1,3-dienyl)pyridine (CID 91023866) is 5-methyl-2-(4-pyridin-2-ylbuta-1,3-dienyl)pyridine.
What is the SMILES notation for 5-methyl-2-(4-pyridin-2-ylbuta-1,3-dienyl)pyridine?
The canonical SMILES for 5-methyl-2-(4-pyridin-2-ylbuta-1,3-dienyl)pyridine is Cc1ccc(C=CC=Cc2ccccn2)nc1.
What is the InChIKey of 5-methyl-2-(4-pyridin-2-ylbuta-1,3-dienyl)pyridine?
The InChIKey is AIQCYSUVMRMQNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2/c1-13-9-10-15(17-12-13)7-3-2-6-14-8-4-5-11-16-14/h2-12H,1H3.
What are the key properties of 5-methyl-2-(4-pyridin-2-ylbuta-1,3-dienyl)pyridine?
5-methyl-2-(4-pyridin-2-ylbuta-1,3-dienyl)pyridine has a molecular weight of 222.29 g/mol, XLogP of 3.51, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-(4-pyridin-2-ylbuta-1,3-dienyl)pyridine is sourced from PubChem (CID 91023866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).