C14H12N2O — CID 91533695
3-(6-pyridin-2-ylhexa-1,3,5-trienyl)-1,2-oxazole (PubChem CID 91533695) has the molecular formula C14H12N2O and a molecular weight of 224.26 g/mol. Its IUPAC name is 3-(6-pyridin-2-ylhexa-1,3,5-trienyl)-1,2-oxazole.
| Compound Name | 3-(6-pyridin-2-ylhexa-1,3,5-trienyl)-1,2-oxazole |
|---|---|
| PubChem CID | 91533695 |
| Molecular Formula | C14H12N2O |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 3-(6-pyridin-2-ylhexa-1,3,5-trienyl)-1,2-oxazole |
| SMILES | C(=CC=Cc1ccon1)C=Cc1ccccn1 |
| InChI | InChI=1S/C14H12N2O/c1(2-4-9-14-10-12-17-16-14)3-7-13-8-5-6-11-15-13/h1-12H |
| InChIKey | GHPPXNJBOVEOLI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|