C15H16N2 — CID 142726970
N-cyclopentyl-1-quinolin-2-ylmethanimine (PubChem CID 142726970) has the molecular formula C15H16N2 and a molecular weight of 224.31 g/mol. Its IUPAC name is N-cyclopentyl-1-quinolin-2-ylmethanimine.
| Compound Name | N-cyclopentyl-1-quinolin-2-ylmethanimine |
|---|---|
| PubChem CID | 142726970 |
| Molecular Formula | C15H16N2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | N-cyclopentyl-1-quinolin-2-ylmethanimine |
| SMILES | C(=N/C1CCCC1)\c1ccc2ccccc2n1 |
| InChI | InChI=1S/C15H16N2/c1-4-8-15-12(5-1)9-10-14(17-15)11-16-13-6-2-3-7-13/h1,4-5,8-11,13H,2-3,6-7H2/b16-11+ |
| InChIKey | BQIDHXNYVUQBBF-LFIBNONCSA-N |
| XLogP | 3.60 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|