C15H18N4 — CID 61361524
N-amino-N'-cyclopentylquinoline-2-carboximidamide (PubChem CID 61361524) has the molecular formula C15H18N4 and a molecular weight of 254.34 g/mol. Its IUPAC name is N-amino-N'-cyclopentylquinoline-2-carboximidamide.
| Compound Name | N-amino-N'-cyclopentylquinoline-2-carboximidamide |
|---|---|
| PubChem CID | 61361524 |
| Molecular Formula | C15H18N4 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | N-amino-N'-cyclopentylquinoline-2-carboximidamide |
| SMILES | NN/C(=N\C1CCCC1)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C15H18N4/c16-19-15(17-12-6-2-3-7-12)14-10-9-11-5-1-4-8-13(11)18-14/h1,4-5,8-10,12H,2-3,6-7,16H2,(H,17,19) |
| InChIKey | VONZJXRYCPUYNQ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|