C16H20N4 — CID 62875588
N-amino-N'-cyclohexylquinoline-6-carboximidamide (PubChem CID 62875588) has the molecular formula C16H20N4 and a molecular weight of 268.36 g/mol. Its IUPAC name is N-amino-N'-cyclohexylquinoline-6-carboximidamide.
| Compound Name | N-amino-N'-cyclohexylquinoline-6-carboximidamide |
|---|---|
| PubChem CID | 62875588 |
| Molecular Formula | C16H20N4 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | N-amino-N'-cyclohexylquinoline-6-carboximidamide |
| SMILES | NN/C(=N\C1CCCCC1)c1ccc2ncccc2c1 |
| InChI | InChI=1S/C16H20N4/c17-20-16(19-14-6-2-1-3-7-14)13-8-9-15-12(11-13)5-4-10-18-15/h4-5,8-11,14H,1-3,6-7,17H2,(H,19,20) |
| InChIKey | XNMBNDIOAIMBCS-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|