C26H22N8 — CID 177496979
4-N,6-N-dimethyl-4-N,6-N-bis[(E)-quinolin-2-ylmethylideneamino]pyrimidine-4,6-diamine (PubChem CID 177496979) has the molecular formula C26H22N8 and a molecular weight of 446.52 g/mol. Its IUPAC name is 4-N,6-N-dimethyl-4-N,6-N-bis[(E)-quinolin-2-ylmethylideneamino]pyrimidine-4,6-diamine.
| Compound Name | 4-N,6-N-dimethyl-4-N,6-N-bis[(E)-quinolin-2-ylmethylideneamino]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 177496979 |
| Molecular Formula | C26H22N8 |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 4-N,6-N-dimethyl-4-N,6-N-bis[(E)-quinolin-2-ylmethylideneamino]pyrimidine-4,6-diamine |
| SMILES | CN(/N=C/c1ccc2ccccc2n1)c1cc(N(C)/N=C/c2ccc3ccccc3n2)ncn1 |
| InChI | InChI=1S/C26H22N8/c1-33(29-16-21-13-11-19-7-3-5-9-23(19)31-21)25-15-26(28-18-27-25)34(2)30-17-22-14-12-20-8-4-6-10-24(20)32-22/h3-18H,1-2H3/b29-16+,30-17+ |
| InChIKey | PDYFNTIJBPHESM-RKMZGRCJSA-N |
| XLogP | 4.51 |
| TPSA | 82.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|