About CID 166625050
CID 166625050 (PubChem CID 166625050) has the molecular formula C13H13ClInN4S
and a molecular weight of 407.61 g/mol.
Molecular Properties
| Compound Name | CID 166625050 |
| PubChem CID | 166625050 |
| Molecular Formula | C13H13ClInN4S |
| Molecular Weight | 407.61 g/mol |
| Exact Mass | 406.96 |
| IUPAC Name | — |
| SMILES | CN(C)/C(=N/N=C/c1ccc2ccccc2n1)S[In]Cl |
| InChI | InChI=1S/C13H14N4S.ClH.In/c1-17(2)13(18)16-14-9-11-8-7-10-5-3-4-6-12(10)15-11;;/h3-9H,1-2H3,(H,16,18);1H;/q;;+2/p-2/b14-9+;; |
| InChIKey | UONWAYHNZCSNIT-CAJRCRMVSA-L |
| XLogP | 2.99 |
| TPSA | 40.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.61 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 166625050 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 166625050?
The IUPAC name of CID 166625050 (CID 166625050) is not available.
What is the SMILES notation for CID 166625050?
The canonical SMILES for CID 166625050 is CN(C)/C(=N/N=C/c1ccc2ccccc2n1)S[In]Cl.
What is the InChIKey of CID 166625050?
The InChIKey is UONWAYHNZCSNIT-CAJRCRMVSA-L. The full InChI is InChI=1S/C13H14N4S.ClH.In/c1-17(2)13(18)16-14-9-11-8-7-10-5-3-4-6-12(10)15-11;;/h3-9H,1-2H3,(H,16,18);1H;/q;;+2/p-2/b14-9+;;.
What are the key properties of CID 166625050?
CID 166625050 has a molecular weight of 407.61 g/mol, XLogP of 2.99, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 166625050 is sourced from PubChem (CID 166625050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).