C18H16N4S — CID 46206773
1-(3-methylphenyl)-3-[(E)-quinolin-2-ylmethylideneamino]thiourea (PubChem CID 46206773) has the molecular formula C18H16N4S and a molecular weight of 320.42 g/mol. Its IUPAC name is 1-(3-methylphenyl)-3-[(E)-quinolin-2-ylmethylideneamino]thiourea.
| Compound Name | 1-(3-methylphenyl)-3-[(E)-quinolin-2-ylmethylideneamino]thiourea |
|---|---|
| PubChem CID | 46206773 |
| Molecular Formula | C18H16N4S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | 1-(3-methylphenyl)-3-[(E)-quinolin-2-ylmethylideneamino]thiourea |
| SMILES | Cc1cccc(NC(=S)N/N=C/c2ccc3ccccc3n2)c1 |
| InChI | InChI=1S/C18H16N4S/c1-13-5-4-7-15(11-13)21-18(23)22-19-12-16-10-9-14-6-2-3-8-17(14)20-16/h2-12H,1H3,(H2,21,22,23)/b19-12+ |
| InChIKey | DRYPZXZNHIPURN-XDHOZWIPSA-N |
| XLogP | 3.86 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|