C23H26N4S — CID 46202218
1-[2,6-di(propan-2-yl)phenyl]-3-[(E)-quinolin-2-ylmethylideneamino]thiourea (PubChem CID 46202218) has the molecular formula C23H26N4S and a molecular weight of 390.56 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-3-[(E)-quinolin-2-ylmethylideneamino]thiourea.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-3-[(E)-quinolin-2-ylmethylideneamino]thiourea |
|---|---|
| PubChem CID | 46202218 |
| Molecular Formula | C23H26N4S |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-3-[(E)-quinolin-2-ylmethylideneamino]thiourea |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=S)N/N=C/c1ccc2ccccc2n1 |
| InChI | InChI=1S/C23H26N4S/c1-15(2)19-9-7-10-20(16(3)4)22(19)26-23(28)27-24-14-18-13-12-17-8-5-6-11-21(17)25-18/h5-16H,1-4H3,(H2,26,27,28)/b24-14+ |
| InChIKey | HZQDDJANGCUOOY-ZVHZXABRSA-N |
| XLogP | 5.80 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|