C15H19N5S — CID 9241154
1-(3-methylbutyl)-3-[(Z)-quinoxalin-2-ylmethylideneamino]thiourea (PubChem CID 9241154) has the molecular formula C15H19N5S and a molecular weight of 301.42 g/mol. Its IUPAC name is 1-(3-methylbutyl)-3-[(Z)-quinoxalin-2-ylmethylideneamino]thiourea.
| Compound Name | 1-(3-methylbutyl)-3-[(Z)-quinoxalin-2-ylmethylideneamino]thiourea |
|---|---|
| PubChem CID | 9241154 |
| Molecular Formula | C15H19N5S |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 1-(3-methylbutyl)-3-[(Z)-quinoxalin-2-ylmethylideneamino]thiourea |
| SMILES | CC(C)CCNC(=S)N/N=C\c1cnc2ccccc2n1 |
| InChI | InChI=1S/C15H19N5S/c1-11(2)7-8-16-15(21)20-18-10-12-9-17-13-5-3-4-6-14(13)19-12/h3-6,9-11H,7-8H2,1-2H3,(H2,16,20,21)/b18-10- |
| InChIKey | ZRNKQRVTZDYAQQ-ZDLGFXPLSA-N |
| XLogP | 2.47 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|