C20H21N5O — CID 9040004
N-[(Z)-quinoxalin-2-ylmethylideneamino]-2-(2,4,6-trimethylanilino)acetamide (PubChem CID 9040004) has the molecular formula C20H21N5O and a molecular weight of 347.42 g/mol. Its IUPAC name is N-[(Z)-quinoxalin-2-ylmethylideneamino]-2-(2,4,6-trimethylanilino)acetamide.
| Compound Name | N-[(Z)-quinoxalin-2-ylmethylideneamino]-2-(2,4,6-trimethylanilino)acetamide |
|---|---|
| PubChem CID | 9040004 |
| Molecular Formula | C20H21N5O |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | N-[(Z)-quinoxalin-2-ylmethylideneamino]-2-(2,4,6-trimethylanilino)acetamide |
| SMILES | Cc1cc(C)c(NCC(=O)N/N=C\c2cnc3ccccc3n2)c(C)c1 |
| InChI | InChI=1S/C20H21N5O/c1-13-8-14(2)20(15(3)9-13)22-12-19(26)25-23-11-16-10-21-17-6-4-5-7-18(17)24-16/h4-11,22H,12H2,1-3H3,(H,25,26)/b23-11- |
| InChIKey | NXRIBYOBWABTMG-KSEXSDGBSA-N |
| XLogP | 3.12 |
| TPSA | 79.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|