About N-propan-2-yl-N'-[(Z)-quinoxalin-2-ylmethylideneamino]oxamide
N-propan-2-yl-N'-[(Z)-quinoxalin-2-ylmethylideneamino]oxamide (PubChem CID 9352105) has the molecular formula C14H15N5O2
and a molecular weight of 285.31 g/mol. Its IUPAC name is N-propan-2-yl-N'-[(Z)-quinoxalin-2-ylmethylideneamino]oxamide.
Molecular Properties
| Compound Name | N-propan-2-yl-N'-[(Z)-quinoxalin-2-ylmethylideneamino]oxamide |
| PubChem CID | 9352105 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | N-propan-2-yl-N'-[(Z)-quinoxalin-2-ylmethylideneamino]oxamide |
| SMILES | CC(C)NC(=O)C(=O)N/N=C\c1cnc2ccccc2n1 |
| InChI | InChI=1S/C14H15N5O2/c1-9(2)17-13(20)14(21)19-16-8-10-7-15-11-5-3-4-6-12(11)18-10/h3-9H,1-2H3,(H,17,20)(H,19,21)/b16-8- |
| InChIKey | VNXGRKMYYOYFBW-PXNMLYILSA-N |
| XLogP | 0.60 |
| TPSA | 96.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-propan-2-yl-N'-[(Z)-quinoxalin-2-ylmethylideneamino]oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propan-2-yl-N'-[(Z)-quinoxalin-2-ylmethylideneamino]oxamide?
The IUPAC name of N-propan-2-yl-N'-[(Z)-quinoxalin-2-ylmethylideneamino]oxamide (CID 9352105) is N-propan-2-yl-N'-[(Z)-quinoxalin-2-ylmethylideneamino]oxamide.
What is the SMILES notation for N-propan-2-yl-N'-[(Z)-quinoxalin-2-ylmethylideneamino]oxamide?
The canonical SMILES for N-propan-2-yl-N'-[(Z)-quinoxalin-2-ylmethylideneamino]oxamide is CC(C)NC(=O)C(=O)N/N=C\c1cnc2ccccc2n1.
What is the InChIKey of N-propan-2-yl-N'-[(Z)-quinoxalin-2-ylmethylideneamino]oxamide?
The InChIKey is VNXGRKMYYOYFBW-PXNMLYILSA-N. The full InChI is InChI=1S/C14H15N5O2/c1-9(2)17-13(20)14(21)19-16-8-10-7-15-11-5-3-4-6-12(11)18-10/h3-9H,1-2H3,(H,17,20)(H,19,21)/b16-8-.
What are the key properties of N-propan-2-yl-N'-[(Z)-quinoxalin-2-ylmethylideneamino]oxamide?
N-propan-2-yl-N'-[(Z)-quinoxalin-2-ylmethylideneamino]oxamide has a molecular weight of 285.31 g/mol, XLogP of 0.60, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-propan-2-yl-N'-[(Z)-quinoxalin-2-ylmethylideneamino]oxamide is sourced from PubChem (CID 9352105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).