C18H23N5S — CID 11938271
1-[(1S,2R,3S)-2,3-dimethylcyclohexyl]-3-[(Z)-quinoxalin-2-ylmethylideneamino]thiourea (PubChem CID 11938271) has the molecular formula C18H23N5S and a molecular weight of 341.48 g/mol. Its IUPAC name is 1-[(1S,2R,3S)-2,3-dimethylcyclohexyl]-3-[(Z)-quinoxalin-2-ylmethylideneamino]thiourea.
| Compound Name | 1-[(1S,2R,3S)-2,3-dimethylcyclohexyl]-3-[(Z)-quinoxalin-2-ylmethylideneamino]thiourea |
|---|---|
| PubChem CID | 11938271 |
| Molecular Formula | C18H23N5S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 1-[(1S,2R,3S)-2,3-dimethylcyclohexyl]-3-[(Z)-quinoxalin-2-ylmethylideneamino]thiourea |
| SMILES | C[C@H]1[C@@H](NC(=S)N/N=C\c2cnc3ccccc3n2)CCC[C@@H]1C |
| InChI | InChI=1S/C18H23N5S/c1-12-6-5-9-15(13(12)2)22-18(24)23-20-11-14-10-19-16-7-3-4-8-17(16)21-14/h3-4,7-8,10-13,15H,5-6,9H2,1-2H3,(H2,22,23,24)/b20-11-/t12-,13+,15-/m0/s1 |
| InChIKey | BOCSDJZCLPJTSW-XDJMIODTSA-N |
| XLogP | 3.25 |
| TPSA | 62.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|