About 2-sulfosulfonylquinoline
2-sulfosulfonylquinoline (PubChem CID 175503554) has the molecular formula C9H7NO5S2
and a molecular weight of 273.29 g/mol. Its IUPAC name is 2-sulfosulfonylquinoline.
Molecular Properties
| Compound Name | 2-sulfosulfonylquinoline |
| PubChem CID | 175503554 |
| Molecular Formula | C9H7NO5S2 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 272.98 |
| IUPAC Name | 2-sulfosulfonylquinoline |
| SMILES | O=S(=O)(O)S(=O)(=O)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C9H7NO5S2/c11-16(12,17(13,14)15)9-6-5-7-3-1-2-4-8(7)10-9/h1-6H,(H,13,14,15) |
| InChIKey | SULPTNLZATZGOP-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 101.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfosulfonylquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfosulfonylquinoline?
The IUPAC name of 2-sulfosulfonylquinoline (CID 175503554) is 2-sulfosulfonylquinoline.
What is the SMILES notation for 2-sulfosulfonylquinoline?
The canonical SMILES for 2-sulfosulfonylquinoline is O=S(=O)(O)S(=O)(=O)c1ccc2ccccc2n1.
What is the InChIKey of 2-sulfosulfonylquinoline?
The InChIKey is SULPTNLZATZGOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO5S2/c11-16(12,17(13,14)15)9-6-5-7-3-1-2-4-8(7)10-9/h1-6H,(H,13,14,15).
What are the key properties of 2-sulfosulfonylquinoline?
2-sulfosulfonylquinoline has a molecular weight of 273.29 g/mol, XLogP of 0.81, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfosulfonylquinoline is sourced from PubChem (CID 175503554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).