About copper;quinoline;sulfuric acid
copper;quinoline;sulfuric acid (PubChem CID 174956434) has the molecular formula C9H9CuNO4S
and a molecular weight of 290.79 g/mol. Its IUPAC name is copper;quinoline;sulfuric acid.
Molecular Properties
| Compound Name | copper;quinoline;sulfuric acid |
| PubChem CID | 174956434 |
| Molecular Formula | C9H9CuNO4S |
| Molecular Weight | 290.79 g/mol |
| Exact Mass | 289.95 |
| IUPAC Name | copper;quinoline;sulfuric acid |
| SMILES | O=S(=O)(O)O.[Cu].c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.Cu.H2O4S/c1-2-6-9-8(4-1)5-3-7-10-9;;1-5(2,3)4/h1-7H;;(H2,1,2,3,4) |
| InChIKey | QFXSYKAWBQXRGX-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.79 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze copper;quinoline;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;quinoline;sulfuric acid?
The IUPAC name of copper;quinoline;sulfuric acid (CID 174956434) is copper;quinoline;sulfuric acid.
What is the SMILES notation for copper;quinoline;sulfuric acid?
The canonical SMILES for copper;quinoline;sulfuric acid is O=S(=O)(O)O.[Cu].c1ccc2ncccc2c1.
What is the InChIKey of copper;quinoline;sulfuric acid?
The InChIKey is QFXSYKAWBQXRGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.Cu.H2O4S/c1-2-6-9-8(4-1)5-3-7-10-9;;1-5(2,3)4/h1-7H;;(H2,1,2,3,4).
What are the key properties of copper;quinoline;sulfuric acid?
copper;quinoline;sulfuric acid has a molecular weight of 290.79 g/mol, XLogP of 1.58, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for copper;quinoline;sulfuric acid is sourced from PubChem (CID 174956434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).