About methanesulfonic acid;quinoline;thiophene
methanesulfonic acid;quinoline;thiophene (PubChem CID 174658970) has the molecular formula C14H15NO3S2
and a molecular weight of 309.41 g/mol. Its IUPAC name is methanesulfonic acid;quinoline;thiophene.
Molecular Properties
| Compound Name | methanesulfonic acid;quinoline;thiophene |
| PubChem CID | 174658970 |
| Molecular Formula | C14H15NO3S2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | methanesulfonic acid;quinoline;thiophene |
| SMILES | CS(=O)(=O)O.c1ccc2ncccc2c1.c1ccsc1 |
| InChI | InChI=1S/C9H7N.C4H4S.CH4O3S/c1-2-6-9-8(4-1)5-3-7-10-9;1-2-4-5-3-1;1-5(2,3)4/h1-7H;1-4H;1H3,(H,2,3,4) |
| InChIKey | WZUJFRCDKZUYNP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze methanesulfonic acid;quinoline;thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanesulfonic acid;quinoline;thiophene?
The IUPAC name of methanesulfonic acid;quinoline;thiophene (CID 174658970) is methanesulfonic acid;quinoline;thiophene.
What is the SMILES notation for methanesulfonic acid;quinoline;thiophene?
The canonical SMILES for methanesulfonic acid;quinoline;thiophene is CS(=O)(=O)O.c1ccc2ncccc2c1.c1ccsc1.
What is the InChIKey of methanesulfonic acid;quinoline;thiophene?
The InChIKey is WZUJFRCDKZUYNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C4H4S.CH4O3S/c1-2-6-9-8(4-1)5-3-7-10-9;1-2-4-5-3-1;1-5(2,3)4/h1-7H;1-4H;1H3,(H,2,3,4).
What are the key properties of methanesulfonic acid;quinoline;thiophene?
methanesulfonic acid;quinoline;thiophene has a molecular weight of 309.41 g/mol, XLogP of 3.49, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanesulfonic acid;quinoline;thiophene is sourced from PubChem (CID 174658970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).